Cedrene
IUPAC NAme: -
CAS Number: 11028-42-5
Class: -
Plants contain this compound
1 plants
| HerbID |
Thai name |
Common name |
Scientific name |
Family |
| 34 |
ช้าพลู |
- |
Piper sarmentosum Roxb. |
Piperaceae |
2D Structure
Compound Properties
Smile
[H][C@]12C[C@@]3(CC=C1C)[C@H](C)CC[C@@]3([H])C2(C)C
Physicochemical Properties
| Formula |
C15H24 |
| Molecular wieght(g/mol) |
204.35 |
| Num. of Heavy atoms |
15 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.87 |
| Num. of Rotatable bonds |
0 |
| Num. of H-bond acceptors |
0 |
| Num. of H-bonds donors |
0 |
| Molar Refractivity |
66.88 |
| TPSA (square Angstrom) |
0.00 |
Lipophilicity
| iLOGP |
3.20 |
| XLOGP3 |
4.62 |
| WLOGP |
4.42 |
| MLOGP |
5.65 |
| Silicos-IT LOGP |
3.91 |
| Consensus LOGP |
4.36 |
Water Solubility
| ESOL |
|
| LogS |
-4.02 |
Solubility(mg/ml) |
1.96E-02 |
Solubility(mol/l) |
9.60E-05 |
Class |
Moderately soluble |
| Ali |
|
| LogS |
-4.35 |
Solubility(mg/ml) |
9.23E-03 |
Solubility(mol/l) |
4.51E-05 |
Class |
Moderately soluble |
| Silicos-IT |
|
| LogS |
-3.52 |
Solubility(mg/ml) |
6.19E-02 |
Solubility(mol/l) |
3.03E-04 |
Class |
Soluble |
Pharmacokinetics
| GI absorbtion |
Low |
| BBB permeant |
No |
| Pgp substrate |
No |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
Yes |
| CYP2C9 inhibitor |
Yes |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
No |
| Log Kp (skin permeation) (cm/s) |
-4.27 |
Druglikeness
| Lipinski Num. violations |
1 |
| Ghose Num. violations |
0 |
| Veber Num. violations |
0 |
| Egan Num. violations |
0 |
| Muegge Num. violations |
1 |
| Bioavailability Score |
0.55 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
1 |
| Leadlikeness Num. of violations |
2 |
| Synthetic Accessibility |
5.53 |
